C14H23FIN3O2S — CID 111824631
1,1-diethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111824631) has the molecular formula C14H23FIN3O2S and a molecular weight of 443.33 g/mol. Its IUPAC name is 1,1-diethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111824631 |
| Molecular Formula | C14H23FIN3O2S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1,1-diethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C14H22FN3O2S.HI/c1-4-18(5-2)14(16)17-9-12-8-13(15)7-6-11(12)10-21(3,19)20;/h6-8H,4-5,9-10H2,1-3H3,(H2,16,17);1H |
| InChIKey | DBZYAOHKTYPXJO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|