C14H23FIN3O2S — CID 111824637
1-tert-butyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111824637) has the molecular formula C14H23FIN3O2S and a molecular weight of 443.33 g/mol. Its IUPAC name is 1-tert-butyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111824637 |
| Molecular Formula | C14H23FIN3O2S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1-tert-butyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CC(C)(C)N/C(N)=N/Cc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C14H22FN3O2S.HI/c1-14(2,3)18-13(16)17-8-11-7-12(15)6-5-10(11)9-21(4,19)20;/h5-7H,8-9H2,1-4H3,(H3,16,17,18);1H |
| InChIKey | FBZYMEXBOJGENM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|