C16H23N5O — CID 111824839
3-methyl-N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]piperidine-1-carboximidamide (PubChem CID 111824839) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-methyl-N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111824839 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 3-methyl-N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CCn2c(=O)[nH]c3ccccc32)C1 |
| InChI | InChI=1S/C16H23N5O/c1-12-5-4-9-20(11-12)15(17)18-8-10-21-14-7-3-2-6-13(14)19-16(21)22/h2-3,6-7,12H,4-5,8-11H2,1H3,(H2,17,18)(H,19,22) |
| InChIKey | XFFHXHDAZZVPHP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|