C17H21N7OS — CID 111824823
N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111824823) has the molecular formula C17H21N7OS and a molecular weight of 371.47 g/mol. Its IUPAC name is N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111824823 |
| Molecular Formula | C17H21N7OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N'-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCn1c(=O)[nH]c2ccccc21)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H21N7OS/c18-15(22-8-10-23(11-9-22)17-20-6-12-26-17)19-5-7-24-14-4-2-1-3-13(14)21-16(24)25/h1-4,6,12H,5,7-11H2,(H2,18,19)(H,21,25) |
| InChIKey | ZTZPQROASNJYKT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|