C15H20N6O2S — CID 111042852
N-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide (PubChem CID 111042852) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111042852 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[2-[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide |
| SMILES | N/C(=N\CCNC(=O)c1ccco1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H20N6O2S/c16-14(18-4-3-17-13(22)12-2-1-10-23-12)20-6-8-21(9-7-20)15-19-5-11-24-15/h1-2,5,10-11H,3-4,6-9H2,(H2,16,18)(H,17,22) |
| InChIKey | TYGZMNMHCVXUFE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|