C17H21N7S — CID 111033452
N'-[(1-methylbenzimidazol-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111033452) has the molecular formula C17H21N7S and a molecular weight of 355.47 g/mol. Its IUPAC name is N'-[(1-methylbenzimidazol-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(1-methylbenzimidazol-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111033452 |
| Molecular Formula | C17H21N7S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N'-[(1-methylbenzimidazol-2-yl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cn1c(C/N=C(\N)N2CCN(c3nccs3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C17H21N7S/c1-22-14-5-3-2-4-13(14)21-15(22)12-20-16(18)23-7-9-24(10-8-23)17-19-6-11-25-17/h2-6,11H,7-10,12H2,1H3,(H2,18,20) |
| InChIKey | OSTRECXVRJYJOH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|