C24H32NO2P — CID 11182542
2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yloxy-bis(2-methylphenyl)phosphane (PubChem CID 11182542) has the molecular formula C24H32NO2P and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yloxy-bis(2-methylphenyl)phosphane.
| Compound Name | 2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yloxy-bis(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 11182542 |
| Molecular Formula | C24H32NO2P |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yloxy-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(OC(C)(C)C1=N[C@@H](C(C)(C)C)CO1)c1ccccc1C |
| InChI | InChI=1S/C24H32NO2P/c1-17-12-8-10-14-19(17)28(20-15-11-9-13-18(20)2)27-24(6,7)22-25-21(16-26-22)23(3,4)5/h8-15,21H,16H2,1-7H3/t21-/m1/s1 |
| InChIKey | JDLOPZSZFIJWHS-OAQYLSRUSA-N |
| XLogP | 5.29 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|