C20H28FN5OS2 — CID 111830255
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111830255) has the molecular formula C20H28FN5OS2 and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111830255 |
| Molecular Formula | C20H28FN5OS2 |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | C/N=C(\NCCCSc1nccs1)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H28FN5OS2/c1-22-19(23-7-2-13-28-20-24-8-14-29-20)25-15-18(26-9-11-27-12-10-26)16-3-5-17(21)6-4-16/h3-6,8,14,18H,2,7,9-13,15H2,1H3,(H2,22,23,25) |
| InChIKey | RDFSNOJSUCZSHG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|