C18H26IN3O3S2 — CID 111838726
1-ethyl-3-[2-(4-methylsulfonylphenoxy)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111838726) has the molecular formula C18H26IN3O3S2 and a molecular weight of 523.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylsulfonylphenoxy)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methylsulfonylphenoxy)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111838726 |
| Molecular Formula | C18H26IN3O3S2 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylsulfonylphenoxy)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccs1)NCCOc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C18H25N3O3S2.HI/c1-3-19-18(20-11-10-16-5-4-14-25-16)21-12-13-24-15-6-8-17(9-7-15)26(2,22)23;/h4-9,14H,3,10-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | UCDHZYZWPJEKKW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|