C23H24N4O7S — CID 1118457
4-[[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide (PubChem CID 1118457) has the molecular formula C23H24N4O7S and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-[[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide.
| Compound Name | 4-[[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 1118457 |
| Molecular Formula | C23H24N4O7S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 4-[[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| SMILES | COc1ccc(C(=O)C=CNc2ccc(S(=O)(=O)Nc3cc(OC)nc(OC)n3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H24N4O7S/c1-31-16-7-10-18(20(13-16)32-2)19(28)11-12-24-15-5-8-17(9-6-15)35(29,30)27-21-14-22(33-3)26-23(25-21)34-4/h5-14,24H,1-4H3,(H,25,26,27) |
| InChIKey | IDUOIXNYZAYMLY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|