C18H32O3 — CID 11185565
(1S,4R,5S,7S)-5-decyl-7-ethenyl-6,8-dioxabicyclo[3.2.1]octan-4-ol (PubChem CID 11185565) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (1S,4R,5S,7S)-5-decyl-7-ethenyl-6,8-dioxabicyclo[3.2.1]octan-4-ol.
| Compound Name | (1S,4R,5S,7S)-5-decyl-7-ethenyl-6,8-dioxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 11185565 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (1S,4R,5S,7S)-5-decyl-7-ethenyl-6,8-dioxabicyclo[3.2.1]octan-4-ol |
| SMILES | C=C[C@@H]1O[C@]2(CCCCCCCCCC)O[C@H]1CC[C@H]2O |
| InChI | InChI=1S/C18H32O3/c1-3-5-6-7-8-9-10-11-14-18-17(19)13-12-16(21-18)15(4-2)20-18/h4,15-17,19H,2-3,5-14H2,1H3/t15-,16-,17+,18+/m0/s1 |
| InChIKey | DUEKMNSZQMWSIH-WNRNVDISSA-N |
| XLogP | 4.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|