C16H18N2S2 — CID 11185739
3-[2-(3-aminophenyl)-1,3-dithian-2-yl]aniline (PubChem CID 11185739) has the molecular formula C16H18N2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 3-[2-(3-aminophenyl)-1,3-dithian-2-yl]aniline.
| Compound Name | 3-[2-(3-aminophenyl)-1,3-dithian-2-yl]aniline |
|---|---|
| PubChem CID | 11185739 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-[2-(3-aminophenyl)-1,3-dithian-2-yl]aniline |
| SMILES | Nc1cccc(C2(c3cccc(N)c3)SCCCS2)c1 |
| InChI | InChI=1S/C16H18N2S2/c17-14-6-1-4-12(10-14)16(19-8-3-9-20-16)13-5-2-7-15(18)11-13/h1-2,4-7,10-11H,3,8-9,17-18H2 |
| InChIKey | YYDWCLVAOYIIJX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|