C20H20O2S2 — CID 20697395
[3-(2-phenyl-1,3-dithian-2-yl)phenyl] 2-methylprop-2-enoate (PubChem CID 20697395) has the molecular formula C20H20O2S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is [3-(2-phenyl-1,3-dithian-2-yl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-phenyl-1,3-dithian-2-yl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20697395 |
| Molecular Formula | C20H20O2S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [3-(2-phenyl-1,3-dithian-2-yl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cccc(C2(c3ccccc3)SCCCS2)c1 |
| InChI | InChI=1S/C20H20O2S2/c1-15(2)19(21)22-18-11-6-10-17(14-18)20(23-12-7-13-24-20)16-8-4-3-5-9-16/h3-6,8-11,14H,1,7,12-13H2,2H3 |
| InChIKey | RHDNVCXWIRDFCP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|