C12H19NO2 — CID 142184021
ethane;3-(2-methyl-1,3-dioxolan-2-yl)aniline (PubChem CID 142184021) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;3-(2-methyl-1,3-dioxolan-2-yl)aniline.
| Compound Name | ethane;3-(2-methyl-1,3-dioxolan-2-yl)aniline |
|---|---|
| PubChem CID | 142184021 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethane;3-(2-methyl-1,3-dioxolan-2-yl)aniline |
| SMILES | CC.CC1(c2cccc(N)c2)OCCO1 |
| InChI | InChI=1S/C10H13NO2.C2H6/c1-10(12-5-6-13-10)8-3-2-4-9(11)7-8;1-2/h2-4,7H,5-6,11H2,1H3;1-2H3 |
| InChIKey | LKEKOYZIQOKBQM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|