C19H21F3N4O2 — CID 111871583
3-[[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111871583) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 3-[[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111871583 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)cc1)NCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-24-18(26-11-14-3-2-4-15(9-14)17(23)27)25-10-13-5-7-16(8-6-13)28-12-19(20,21)22/h2-9H,10-12H2,1H3,(H2,23,27)(H2,24,25,26) |
| InChIKey | APKXLMUSHCMUFF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|