C9H3F13O — CID 11187961
3,3,4,5,5,6,6-heptafluoro-1-methoxy-2,4-bis(trifluoromethyl)cyclohexene (PubChem CID 11187961) has the molecular formula C9H3F13O and a molecular weight of 374.10 g/mol. Its IUPAC name is 3,3,4,5,5,6,6-heptafluoro-1-methoxy-2,4-bis(trifluoromethyl)cyclohexene.
| Compound Name | 3,3,4,5,5,6,6-heptafluoro-1-methoxy-2,4-bis(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 11187961 |
| Molecular Formula | C9H3F13O |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 3,3,4,5,5,6,6-heptafluoro-1-methoxy-2,4-bis(trifluoromethyl)cyclohexene |
| SMILES | COC1=C(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H3F13O/c1-23-3-2(6(14,15)16)4(10,11)7(17,9(20,21)22)8(18,19)5(3,12)13/h1H3 |
| InChIKey | DDZRXSMXLCXAOW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|