C15H31N5O3 — CID 111886315
tert-butyl N-[3-[[N-[3-(dimethylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111886315) has the molecular formula C15H31N5O3 and a molecular weight of 329.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[3-(dimethylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[3-(dimethylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886315 |
| Molecular Formula | C15H31N5O3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | tert-butyl N-[3-[[N-[3-(dimethylamino)-3-oxopropyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(/NCCCNC(=O)OC(C)(C)C)NCCC(=O)N(C)C |
| InChI | InChI=1S/C15H31N5O3/c1-15(2,3)23-14(22)19-10-7-9-17-13(16-4)18-11-8-12(21)20(5)6/h7-11H2,1-6H3,(H,19,22)(H2,16,17,18) |
| InChIKey | SIORULQGVSZHBT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|