C17H29IN6OS — CID 111894130
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111894130) has the molecular formula C17H29IN6OS and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111894130 |
| Molecular Formula | C17H29IN6OS |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NCc1sccc1C.I |
| InChI | InChI=1S/C17H28N6OS.HI/c1-5-24-9-6-8-18-17(19-11-15-13(2)7-10-25-15)20-12-16-22-21-14(3)23(16)4;/h7,10H,5-6,8-9,11-12H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | QHBMLPIILZORCD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|