C19H34IN7O2 — CID 111595062
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide (PubChem CID 111595062) has the molecular formula C19H34IN7O2 and a molecular weight of 519.43 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111595062 |
| Molecular Formula | C19H34IN7O2 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C19H33N7O2.HI/c1-7-27-10-8-9-20-18(22-12-16-25-24-14(2)26(16)6)23-13-17-21-11-15(28-17)19(3,4)5;/h11H,7-10,12-13H2,1-6H3,(H2,20,22,23);1H |
| InChIKey | WIAQDRRKTZXWBS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|