C27H35N3O2 — CID 11189715
(2E)-4-[(4-tert-butylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one (PubChem CID 11189715) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (2E)-4-[(4-tert-butylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one.
| Compound Name | (2E)-4-[(4-tert-butylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one |
|---|---|
| PubChem CID | 11189715 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (2E)-4-[(4-tert-butylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one |
| SMILES | CN1CCN(c2ccccc2/C=C2/OCCN(Cc3ccc(C(C)(C)C)cc3)C2=O)CC1 |
| InChI | InChI=1S/C27H35N3O2/c1-27(2,3)23-11-9-21(10-12-23)20-30-17-18-32-25(26(30)31)19-22-7-5-6-8-24(22)29-15-13-28(4)14-16-29/h5-12,19H,13-18,20H2,1-4H3/b25-19+ |
| InChIKey | RUHHPPRQYOZZRU-NCELDCMTSA-N |
| XLogP | 4.14 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|