C23H26ClN3O2 — CID 11452652
(2E)-4-[(4-chlorophenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one (PubChem CID 11452652) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is (2E)-4-[(4-chlorophenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one.
| Compound Name | (2E)-4-[(4-chlorophenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one |
|---|---|
| PubChem CID | 11452652 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2E)-4-[(4-chlorophenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one |
| SMILES | CN1CCN(c2ccccc2/C=C2/OCCN(Cc3ccc(Cl)cc3)C2=O)CC1 |
| InChI | InChI=1S/C23H26ClN3O2/c1-25-10-12-26(13-11-25)21-5-3-2-4-19(21)16-22-23(28)27(14-15-29-22)17-18-6-8-20(24)9-7-18/h2-9,16H,10-15,17H2,1H3/b22-16+ |
| InChIKey | ZSMOCAAUHXCNHE-CJLVFECKSA-N |
| XLogP | 3.49 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|