C22H21Cl2N3O2S — CID 54074424
4-(3,4-dichlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3,5-dione (PubChem CID 54074424) has the molecular formula C22H21Cl2N3O2S and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3,5-dione.
| Compound Name | 4-(3,4-dichlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 54074424 |
| Molecular Formula | C22H21Cl2N3O2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3,5-dione |
| SMILES | CN1CCN(c2ccccc2C=C2SCC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H21Cl2N3O2S/c1-25-8-10-26(11-9-25)19-5-3-2-4-15(19)12-20-22(29)27(21(28)14-30-20)16-6-7-17(23)18(24)13-16/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | MIROCPFMNLECCQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|