C22H22BrCl2N3OS — CID 54369936
2-[[4-bromo-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one (PubChem CID 54369936) has the molecular formula C22H22BrCl2N3OS and a molecular weight of 527.32 g/mol. Its IUPAC name is 2-[[4-bromo-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one.
| Compound Name | 2-[[4-bromo-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one |
|---|---|
| PubChem CID | 54369936 |
| Molecular Formula | C22H22BrCl2N3OS |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | 2-[[4-bromo-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one |
| SMILES | CN1CCN(c2cc(Br)ccc2C=C2SCCN(c3ccc(Cl)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H22BrCl2N3OS/c1-26-6-8-27(9-7-26)20-13-16(23)3-2-15(20)12-21-22(29)28(10-11-30-21)17-4-5-18(24)19(25)14-17/h2-5,12-14H,6-11H2,1H3 |
| InChIKey | USLIZPFIHOOADH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|