C23H26N4OS — CID 22346513
(2Z)-2-[[2-(4-cyclopropylpiperazin-1-yl)phenyl]methylidene]-4-pyridin-3-ylthiomorpholin-3-one (PubChem CID 22346513) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is (2Z)-2-[[2-(4-cyclopropylpiperazin-1-yl)phenyl]methylidene]-4-pyridin-3-ylthiomorpholin-3-one.
| Compound Name | (2Z)-2-[[2-(4-cyclopropylpiperazin-1-yl)phenyl]methylidene]-4-pyridin-3-ylthiomorpholin-3-one |
|---|---|
| PubChem CID | 22346513 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2Z)-2-[[2-(4-cyclopropylpiperazin-1-yl)phenyl]methylidene]-4-pyridin-3-ylthiomorpholin-3-one |
| SMILES | O=C1/C(=C/c2ccccc2N2CCN(C3CC3)CC2)SCCN1c1cccnc1 |
| InChI | InChI=1S/C23H26N4OS/c28-23-22(29-15-14-27(23)20-5-3-9-24-17-20)16-18-4-1-2-6-21(18)26-12-10-25(11-13-26)19-7-8-19/h1-6,9,16-17,19H,7-8,10-15H2/b22-16- |
| InChIKey | ZEHMAZQWJFEHMG-JWGURIENSA-N |
| XLogP | 3.49 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|