C24H27F2N3OS — CID 54149860
4-(3,4-difluorophenyl)-2-[[2-(2,4,5-trimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one (PubChem CID 54149860) has the molecular formula C24H27F2N3OS and a molecular weight of 443.56 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-[[2-(2,4,5-trimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one.
| Compound Name | 4-(3,4-difluorophenyl)-2-[[2-(2,4,5-trimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
|---|---|
| PubChem CID | 54149860 |
| Molecular Formula | C24H27F2N3OS |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-[[2-(2,4,5-trimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
| SMILES | CC1CN(c2ccccc2C=C2SCCN(c3ccc(F)c(F)c3)C2=O)C(C)CN1C |
| InChI | InChI=1S/C24H27F2N3OS/c1-16-15-29(17(2)14-27(16)3)22-7-5-4-6-18(22)12-23-24(30)28(10-11-31-23)19-8-9-20(25)21(26)13-19/h4-9,12-13,16-17H,10-11,14-15H2,1-3H3 |
| InChIKey | OGZLMROQDBYYQO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|