C23H25Cl2N3OS — CID 22346517
(2Z)-4-(3,5-dichlorophenyl)-2-[[2-(2,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one (PubChem CID 22346517) has the molecular formula C23H25Cl2N3OS and a molecular weight of 462.45 g/mol. Its IUPAC name is (2Z)-4-(3,5-dichlorophenyl)-2-[[2-(2,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one.
| Compound Name | (2Z)-4-(3,5-dichlorophenyl)-2-[[2-(2,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
|---|---|
| PubChem CID | 22346517 |
| Molecular Formula | C23H25Cl2N3OS |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (2Z)-4-(3,5-dichlorophenyl)-2-[[2-(2,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
| SMILES | CC1CN(c2ccccc2/C=C2\SCCN(c3cc(Cl)cc(Cl)c3)C2=O)C(C)CN1 |
| InChI | InChI=1S/C23H25Cl2N3OS/c1-15-14-28(16(2)13-26-15)21-6-4-3-5-17(21)9-22-23(29)27(7-8-30-22)20-11-18(24)10-19(25)12-20/h3-6,9-12,15-16,26H,7-8,13-14H2,1-2H3/b22-9- |
| InChIKey | VJZRUROCWRCCLS-AFPJDJCSSA-N |
| XLogP | 5.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|