C27H31N3O3S — CID 69336086
4-(5-benzyl-1,3-dioxol-4-yl)-2-[[2-(3,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one (PubChem CID 69336086) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 4-(5-benzyl-1,3-dioxol-4-yl)-2-[[2-(3,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one.
| Compound Name | 4-(5-benzyl-1,3-dioxol-4-yl)-2-[[2-(3,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
|---|---|
| PubChem CID | 69336086 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-(5-benzyl-1,3-dioxol-4-yl)-2-[[2-(3,5-dimethylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
| SMILES | CC1CN(c2ccccc2C=C2SCCN(C3=C(Cc4ccccc4)OCO3)C2=O)CC(C)N1 |
| InChI | InChI=1S/C27H31N3O3S/c1-19-16-29(17-20(2)28-19)23-11-7-6-10-22(23)15-25-26(31)30(12-13-34-25)27-24(32-18-33-27)14-21-8-4-3-5-9-21/h3-11,15,19-20,28H,12-14,16-18H2,1-2H3 |
| InChIKey | BGJANJJYVKGFFR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|