C23H27Cl2N3O2S — CID 91527259
(2Z)-4-(3,4-dichlorophenyl)-2-[(2-piperazin-1-ylphenyl)methylidene]thiomorpholin-3-one;methoxymethane (PubChem CID 91527259) has the molecular formula C23H27Cl2N3O2S and a molecular weight of 480.46 g/mol. Its IUPAC name is (2Z)-4-(3,4-dichlorophenyl)-2-[(2-piperazin-1-ylphenyl)methylidene]thiomorpholin-3-one;methoxymethane.
| Compound Name | (2Z)-4-(3,4-dichlorophenyl)-2-[(2-piperazin-1-ylphenyl)methylidene]thiomorpholin-3-one;methoxymethane |
|---|---|
| PubChem CID | 91527259 |
| Molecular Formula | C23H27Cl2N3O2S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (2Z)-4-(3,4-dichlorophenyl)-2-[(2-piperazin-1-ylphenyl)methylidene]thiomorpholin-3-one;methoxymethane |
| SMILES | COC.O=C1/C(=C/c2ccccc2N2CCNCC2)SCCN1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2N3OS.C2H6O/c22-17-6-5-16(14-18(17)23)26-11-12-28-20(21(26)27)13-15-3-1-2-4-19(15)25-9-7-24-8-10-25;1-3-2/h1-6,13-14,24H,7-12H2;1-2H3/b20-13-; |
| InChIKey | PPNYGPWEMAITDR-MASIZSFYSA-N |
| XLogP | 4.79 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|