C22H22Cl2FN3OS — CID 67656483
4-(2,3-dichlorophenyl)-2-[[3-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one (PubChem CID 67656483) has the molecular formula C22H22Cl2FN3OS and a molecular weight of 466.41 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-2-[[3-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one.
| Compound Name | 4-(2,3-dichlorophenyl)-2-[[3-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
|---|---|
| PubChem CID | 67656483 |
| Molecular Formula | C22H22Cl2FN3OS |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-2-[[3-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one |
| SMILES | CN1CCN(c2c(F)cccc2C=C2SCCN(c3cccc(Cl)c3Cl)C2=O)CC1 |
| InChI | InChI=1S/C22H22Cl2FN3OS/c1-26-8-10-27(11-9-26)21-15(4-2-6-17(21)25)14-19-22(29)28(12-13-30-19)18-7-3-5-16(23)20(18)24/h2-7,14H,8-13H2,1H3 |
| InChIKey | GNAOLVIXMJXAKL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|