C22H23Cl2N3O — CID 54191443
1-(2,4-dichlorophenyl)-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]pyrrolidin-2-one (PubChem CID 54191443) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]pyrrolidin-2-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]pyrrolidin-2-one |
|---|---|
| PubChem CID | 54191443 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]pyrrolidin-2-one |
| SMILES | CN1CCN(c2ccccc2C=C2CCN(c3ccc(Cl)cc3Cl)C2=O)CC1 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-25-10-12-26(13-11-25)20-5-3-2-4-16(20)14-17-8-9-27(22(17)28)21-7-6-18(23)15-19(21)24/h2-7,14-15H,8-13H2,1H3 |
| InChIKey | PIUONQUJTFNSTR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|