C23H25ClFN3O — CID 54102788
1-(4-chlorophenyl)-3-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperidin-2-one (PubChem CID 54102788) has the molecular formula C23H25ClFN3O and a molecular weight of 413.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperidin-2-one.
| Compound Name | 1-(4-chlorophenyl)-3-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 54102788 |
| Molecular Formula | C23H25ClFN3O |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperidin-2-one |
| SMILES | CN1CCN(c2ccc(F)cc2C=C2CCCN(c3ccc(Cl)cc3)C2=O)CC1 |
| InChI | InChI=1S/C23H25ClFN3O/c1-26-11-13-27(14-12-26)22-9-6-20(25)16-18(22)15-17-3-2-10-28(23(17)29)21-7-4-19(24)5-8-21/h4-9,15-16H,2-3,10-14H2,1H3 |
| InChIKey | NBRKHSQLNPOVMR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|