C23H24Cl2FN3OS — CID 174326589
4-(3,4-dichlorophenyl)-2-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3-carbaldehyde (PubChem CID 174326589) has the molecular formula C23H24Cl2FN3OS and a molecular weight of 480.44 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3-carbaldehyde.
| Compound Name | 4-(3,4-dichlorophenyl)-2-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3-carbaldehyde |
|---|---|
| PubChem CID | 174326589 |
| Molecular Formula | C23H24Cl2FN3OS |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-[[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholine-3-carbaldehyde |
| SMILES | CN1CCN(c2ccc(F)cc2C=C2SCCN(c3ccc(Cl)c(Cl)c3)C2C=O)CC1 |
| InChI | InChI=1S/C23H24Cl2FN3OS/c1-27-6-8-28(9-7-27)21-5-2-17(26)12-16(21)13-23-22(15-30)29(10-11-31-23)18-3-4-19(24)20(25)14-18/h2-5,12-15,22H,6-11H2,1H3 |
| InChIKey | IVWKKDKFPSOARI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|