C24H28Cl2N4O — CID 174369317
1-(3,4-dichlorophenyl)-4-methyl-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperazine-2-carbaldehyde (PubChem CID 174369317) has the molecular formula C24H28Cl2N4O and a molecular weight of 459.42 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-methyl-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperazine-2-carbaldehyde.
| Compound Name | 1-(3,4-dichlorophenyl)-4-methyl-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174369317 |
| Molecular Formula | C24H28Cl2N4O |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-methyl-3-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]piperazine-2-carbaldehyde |
| SMILES | CN1CCN(c2ccccc2C=C2C(C=O)N(c3ccc(Cl)c(Cl)c3)CCN2C)CC1 |
| InChI | InChI=1S/C24H28Cl2N4O/c1-27-9-12-29(13-10-27)22-6-4-3-5-18(22)15-23-24(17-31)30(14-11-28(23)2)19-7-8-20(25)21(26)16-19/h3-8,15-17,24H,9-14H2,1-2H3 |
| InChIKey | WFSNPGLHVRGKDA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|