C25H29Cl2N3OS — CID 54040562
2-[[2-(4-tert-butylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one (PubChem CID 54040562) has the molecular formula C25H29Cl2N3OS and a molecular weight of 490.50 g/mol. Its IUPAC name is 2-[[2-(4-tert-butylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one.
| Compound Name | 2-[[2-(4-tert-butylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one |
|---|---|
| PubChem CID | 54040562 |
| Molecular Formula | C25H29Cl2N3OS |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[[2-(4-tert-butylpiperazin-1-yl)phenyl]methylidene]-4-(3,4-dichlorophenyl)thiomorpholin-3-one |
| SMILES | CC(C)(C)N1CCN(c2ccccc2C=C2SCCN(c3ccc(Cl)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C25H29Cl2N3OS/c1-25(2,3)29-12-10-28(11-13-29)22-7-5-4-6-18(22)16-23-24(31)30(14-15-32-23)19-8-9-20(26)21(27)17-19/h4-9,16-17H,10-15H2,1-3H3 |
| InChIKey | LMAHKLZVJWYTDN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|