C13H22N4 — CID 144702879
3-(3,5-dimethylpiperazin-1-yl)-2-N-methylbenzene-1,2-diamine (PubChem CID 144702879) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperazin-1-yl)-2-N-methylbenzene-1,2-diamine.
| Compound Name | 3-(3,5-dimethylpiperazin-1-yl)-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 144702879 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 3-(3,5-dimethylpiperazin-1-yl)-2-N-methylbenzene-1,2-diamine |
| SMILES | CNc1c(N)cccc1N1CC(C)NC(C)C1 |
| InChI | InChI=1S/C13H22N4/c1-9-7-17(8-10(2)16-9)12-6-4-5-11(14)13(12)15-3/h4-6,9-10,15-16H,7-8,14H2,1-3H3 |
| InChIKey | HHMGMDCBDMCUBC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|