C25H31N3O3 — CID 11362192
(2E)-4-[4-(2-hydroxypropan-2-yl)phenyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one (PubChem CID 11362192) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is (2E)-4-[4-(2-hydroxypropan-2-yl)phenyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one.
| Compound Name | (2E)-4-[4-(2-hydroxypropan-2-yl)phenyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one |
|---|---|
| PubChem CID | 11362192 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (2E)-4-[4-(2-hydroxypropan-2-yl)phenyl]-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]morpholin-3-one |
| SMILES | CN1CCN(c2ccccc2/C=C2/OCCN(c3ccc(C(C)(C)O)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-25(2,30)20-8-10-21(11-9-20)28-16-17-31-23(24(28)29)18-19-6-4-5-7-22(19)27-14-12-26(3)13-15-27/h4-11,18,30H,12-17H2,1-3H3/b23-18+ |
| InChIKey | YBYOQGIMOZAQOB-PTGBLXJZSA-N |
| XLogP | 3.07 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|