C18H13N5O7S — CID 11189956
(3-nitrophenyl) 4-(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzenesulfonate (PubChem CID 11189956) has the molecular formula C18H13N5O7S and a molecular weight of 443.40 g/mol. Its IUPAC name is (3-nitrophenyl) 4-(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzenesulfonate.
| Compound Name | (3-nitrophenyl) 4-(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzenesulfonate |
|---|---|
| PubChem CID | 11189956 |
| Molecular Formula | C18H13N5O7S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | (3-nitrophenyl) 4-(1-methyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzenesulfonate |
| SMILES | Cn1c(=O)[nH]c2nc(-c3ccc(S(=O)(=O)Oc4cccc([N+](=O)[O-])c4)cc3)[nH]c2c1=O |
| InChI | InChI=1S/C18H13N5O7S/c1-22-17(24)14-16(21-18(22)25)20-15(19-14)10-5-7-13(8-6-10)31(28,29)30-12-4-2-3-11(9-12)23(26)27/h2-9H,1H3,(H,19,20)(H,21,25) |
| InChIKey | VZMPXRPOYBIXJK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|