C19H16N5O8S+ — CID 75094744
(3-nitrophenyl) 4-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)carbamoyl]benzenesulfonate (PubChem CID 75094744) has the molecular formula C19H16N5O8S+ and a molecular weight of 474.43 g/mol. Its IUPAC name is (3-nitrophenyl) 4-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)carbamoyl]benzenesulfonate.
| Compound Name | (3-nitrophenyl) 4-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)carbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 75094744 |
| Molecular Formula | C19H16N5O8S+ |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (3-nitrophenyl) 4-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-3-ium-5-ylidene)carbamoyl]benzenesulfonate |
| SMILES | CN1C(=O)/C(=N\C(=O)c2ccc(S(=O)(=O)Oc3cccc([N+](=O)[O-])c3)cc2)C(N)=[N+](C)C1=O |
| InChI | InChI=1S/C19H15N5O8S/c1-22-16(20)15(18(26)23(2)19(22)27)21-17(25)11-6-8-14(9-7-11)33(30,31)32-13-5-3-4-12(10-13)24(28)29/h3-10,20H,1-2H3/p+1/b21-15- |
| InChIKey | QODAXEXAZJLBDL-QNGOZBTKSA-O |
| XLogP | 0.54 |
| TPSA | 182.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|