C17H23F2N5 — CID 111902221
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111902221) has the molecular formula C17H23F2N5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111902221 |
| Molecular Formula | C17H23F2N5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC(C)Cn1cccn1 |
| InChI | InChI=1S/C17H23F2N5/c1-3-20-17(21-10-13(2)12-24-8-4-7-23-24)22-11-14-9-15(18)5-6-16(14)19/h4-9,13H,3,10-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | MDXNMNGNESPNLQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|