C20H21F2N5 — CID 111902737
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine (PubChem CID 111902737) has the molecular formula C20H21F2N5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111902737 |
| Molecular Formula | C20H21F2N5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCc1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C20H21F2N5/c1-2-23-20(25-11-15-10-16(21)8-9-17(15)22)26-13-19-24-12-18(27-19)14-6-4-3-5-7-14/h3-10,12H,2,11,13H2,1H3,(H,24,27)(H2,23,25,26) |
| InChIKey | DFNGDDFKAJESIF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|