C22H37NO7Si — CID 11190284
benzyl (2R,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,4,5-trihydroxypiperidine-1-carboxylate (PubChem CID 11190284) has the molecular formula C22H37NO7Si and a molecular weight of 455.62 g/mol. Its IUPAC name is benzyl (2R,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,4,5-trihydroxypiperidine-1-carboxylate.
| Compound Name | benzyl (2R,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,4,5-trihydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11190284 |
| Molecular Formula | C22H37NO7Si |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | benzyl (2R,3S,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3,4,5-trihydroxypiperidine-1-carboxylate |
| SMILES | CCOC1[C@H](O)[C@H](O)[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H37NO7Si/c1-7-28-20-19(26)18(25)17(24)16(14-30-31(5,6)22(2,3)4)23(20)21(27)29-13-15-11-9-8-10-12-15/h8-12,16-20,24-26H,7,13-14H2,1-6H3/t16-,17+,18-,19-,20?/m1/s1 |
| InChIKey | YOYSMIGQEGKWON-XBYSNUDESA-N |
| XLogP | 2.47 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|