C19H24N6S — CID 111904131
2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111904131) has the molecular formula C19H24N6S and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111904131 |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-methyl-1-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | C/N=C(\NCCCn1cccn1)NCc1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C19H24N6S/c1-15-17(26-18(24-15)16-8-4-3-5-9-16)14-22-19(20-2)21-10-6-12-25-13-7-11-23-25/h3-5,7-9,11,13H,6,10,12,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | LKNUJJDDAYENQJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|