C28H27NO6 — CID 11190666
[4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate (PubChem CID 11190666) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate.
| Compound Name | [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 11190666 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(C)c(C[C@@H](C=O)NC(=O)OCC2c3ccccc3-c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C28H27NO6/c1-17-12-20(35-28(32)33-3)13-18(2)25(17)14-19(15-30)29-27(31)34-16-26-23-10-6-4-8-21(23)22-9-5-7-11-24(22)26/h4-13,15,19,26H,14,16H2,1-3H3,(H,29,31)/t19-/m0/s1 |
| InChIKey | QCTVOTIWVAUXNO-IBGZPJMESA-N |
| XLogP | 5.10 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|