C22H27ClIN5O2 — CID 111911383
2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111911383) has the molecular formula C22H27ClIN5O2 and a molecular weight of 555.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111911383 |
| Molecular Formula | C22H27ClIN5O2 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC(c2ccc(Cl)cc2)n2cccn2)cc1OC.I |
| InChI | InChI=1S/C22H26ClN5O2.HI/c1-29-20-9-4-16(14-21(20)30-2)10-12-25-22(24)26-15-19(28-13-3-11-27-28)17-5-7-18(23)8-6-17;/h3-9,11,13-14,19H,10,12,15H2,1-2H3,(H3,24,25,26);1H |
| InChIKey | DAOMXPXXKGQVBE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|