C17H22F3N5OS — CID 111914036
1-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914036) has the molecular formula C17H22F3N5OS and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914036 |
| Molecular Formula | C17H22F3N5OS |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C17H22F3N5OS/c1-2-21-16(24-12-5-6-25(9-12)11-17(18,19)20)22-8-13-10-26-15(23-13)14-4-3-7-27-14/h3-4,7,10,12H,2,5-6,8-9,11H2,1H3,(H2,21,22,24) |
| InChIKey | IQAIOJDTFQZHCP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|