C27H28N2O9S — CID 11192167
6-O-benzyl 1-O-methyl (5S)-2-(1,3-dioxoisoindol-2-yl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanedioate (PubChem CID 11192167) has the molecular formula C27H28N2O9S and a molecular weight of 556.59 g/mol. Its IUPAC name is 6-O-benzyl 1-O-methyl (5S)-2-(1,3-dioxoisoindol-2-yl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanedioate.
| Compound Name | 6-O-benzyl 1-O-methyl (5S)-2-(1,3-dioxoisoindol-2-yl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanedioate |
|---|---|
| PubChem CID | 11192167 |
| Molecular Formula | C27H28N2O9S |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 6-O-benzyl 1-O-methyl (5S)-2-(1,3-dioxoisoindol-2-yl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxohexanedioate |
| SMILES | COC(=O)C(SN1C(=O)c2ccccc2C1=O)C(=O)C[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O9S/c1-27(2,3)38-26(35)28-19(24(33)37-15-16-10-6-5-7-11-16)14-20(30)21(25(34)36-4)39-29-22(31)17-12-8-9-13-18(17)23(29)32/h5-13,19,21H,14-15H2,1-4H3,(H,28,35)/t19-,21?/m0/s1 |
| InChIKey | IIKJVRULYNTSPR-ZQRQZVKFSA-N |
| XLogP | 3.07 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|