C21H34F2IN5O2 — CID 111922106
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111922106) has the molecular formula C21H34F2IN5O2 and a molecular weight of 553.44 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111922106 |
| Molecular Formula | C21H34F2IN5O2 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCN1CCOC)NC1CCN(c2ccccc2OC(F)F)C1.I |
| InChI | InChI=1S/C21H33F2N5O2.HI/c1-24-21(25-14-17-6-5-10-27(17)12-13-29-2)26-16-9-11-28(15-16)18-7-3-4-8-19(18)30-20(22)23;/h3-4,7-8,16-17,20H,5-6,9-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | VKRBEEGBGLXHRS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|