C32H64O5Si2 — CID 11192546
(2R,5R)-5-[(2R,5R)-5-[(1R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]undecyl]oxolan-2-yl]oxolane-2-carbaldehyde (PubChem CID 11192546) has the molecular formula C32H64O5Si2 and a molecular weight of 585.03 g/mol. Its IUPAC name is (2R,5R)-5-[(2R,5R)-5-[(1R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]undecyl]oxolan-2-yl]oxolane-2-carbaldehyde.
| Compound Name | (2R,5R)-5-[(2R,5R)-5-[(1R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]undecyl]oxolan-2-yl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 11192546 |
| Molecular Formula | C32H64O5Si2 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | (2R,5R)-5-[(2R,5R)-5-[(1R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]undecyl]oxolan-2-yl]oxolane-2-carbaldehyde |
| SMILES | CCCCCC[C@@H](CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]([C@H]2CC[C@H](C=O)O2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H64O5Si2/c1-12-13-14-15-17-25(36-38(8,9)31(2,3)4)18-16-19-30(37-39(10,11)32(5,6)7)29-23-22-28(35-29)27-21-20-26(24-33)34-27/h24-30H,12-23H2,1-11H3/t25-,26+,27+,28+,29+,30+/m0/s1 |
| InChIKey | UUQYCODCSGWOCV-CLKLPDSKSA-N |
| XLogP | 9.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|