C12H18BrN3O3 — CID 111926883
1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea (PubChem CID 111926883) has the molecular formula C12H18BrN3O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is 1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea.
| Compound Name | 1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111926883 |
| Molecular Formula | C12H18BrN3O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
| SMILES | Cn1cc(Br)cc(NC(=O)NC(C)(C)CCO)c1=O |
| InChI | InChI=1S/C12H18BrN3O3/c1-12(2,4-5-17)15-11(19)14-9-6-8(13)7-16(3)10(9)18/h6-7,17H,4-5H2,1-3H3,(H2,14,15,19) |
| InChIKey | XARBYZOKAWVIQB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |