C36H52O7Si — CID 11192913
2-[4,5-dimethoxy-2-[5-(methoxymethoxy)-4-phenylmethoxy-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]phenyl]ethanol (PubChem CID 11192913) has the molecular formula C36H52O7Si and a molecular weight of 624.89 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-[5-(methoxymethoxy)-4-phenylmethoxy-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]phenyl]ethanol.
| Compound Name | 2-[4,5-dimethoxy-2-[5-(methoxymethoxy)-4-phenylmethoxy-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 11192913 |
| Molecular Formula | C36H52O7Si |
| Molecular Weight | 624.89 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | 2-[4,5-dimethoxy-2-[5-(methoxymethoxy)-4-phenylmethoxy-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]phenyl]ethanol |
| SMILES | COCOc1cc(-c2cc(OC)c(OC)cc2CCO)c(CCO[Si](C(C)C)(C(C)C)C(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C36H52O7Si/c1-25(2)44(26(3)4,27(5)6)43-18-16-30-20-35(41-23-28-13-11-10-12-14-28)36(42-24-38-7)22-32(30)31-21-34(40-9)33(39-8)19-29(31)15-17-37/h10-14,19-22,25-27,37H,15-18,23-24H2,1-9H3 |
| InChIKey | ZNWQPLXNRCAXJP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.89 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|